C13H21NO4S2 — CID 64647000
1-(4-methylphenyl)-2-(2-methylsulfonylethylsulfonyl)propan-1-amine (PubChem CID 64647000) has the molecular formula C13H21NO4S2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2-(2-methylsulfonylethylsulfonyl)propan-1-amine.
| Compound Name | 1-(4-methylphenyl)-2-(2-methylsulfonylethylsulfonyl)propan-1-amine |
|---|---|
| PubChem CID | 64647000 |
| Molecular Formula | C13H21NO4S2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 1-(4-methylphenyl)-2-(2-methylsulfonylethylsulfonyl)propan-1-amine |
| SMILES | Cc1ccc(C(N)C(C)S(=O)(=O)CCS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H21NO4S2/c1-10-4-6-12(7-5-10)13(14)11(2)20(17,18)9-8-19(3,15)16/h4-7,11,13H,8-9,14H2,1-3H3 |
| InChIKey | JZKYTGZPELBECU-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 94.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |