C12H15F2NO2S — CID 64652009
3-(2,4-difluorophenyl)sulfinyl-N-methyloxan-4-amine (PubChem CID 64652009) has the molecular formula C12H15F2NO2S and a molecular weight of 275.32 g/mol. Its IUPAC name is 3-(2,4-difluorophenyl)sulfinyl-N-methyloxan-4-amine.
| Compound Name | 3-(2,4-difluorophenyl)sulfinyl-N-methyloxan-4-amine |
|---|---|
| PubChem CID | 64652009 |
| Molecular Formula | C12H15F2NO2S |
| Molecular Weight | 275.32 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 3-(2,4-difluorophenyl)sulfinyl-N-methyloxan-4-amine |
| SMILES | CNC1CCOCC1S(=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C12H15F2NO2S/c1-15-10-4-5-17-7-12(10)18(16)11-3-2-8(13)6-9(11)14/h2-3,6,10,12,15H,4-5,7H2,1H3 |
| InChIKey | CCMOHDUEIFKGCB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.32 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |