C15H23NO2S — CID 64657442
6-(3-methoxypropylsulfinyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine (PubChem CID 64657442) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 6-(3-methoxypropylsulfinyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine.
| Compound Name | 6-(3-methoxypropylsulfinyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine |
|---|---|
| PubChem CID | 64657442 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 6-(3-methoxypropylsulfinyl)-6,7,8,9-tetrahydro-5H-benzo[7]annulen-5-amine |
| SMILES | COCCCS(=O)C1CCCc2ccccc2C1N |
| InChI | InChI=1S/C15H23NO2S/c1-18-10-5-11-19(17)14-9-4-7-12-6-2-3-8-13(12)15(14)16/h2-3,6,8,14-15H,4-5,7,9-11,16H2,1H3 |
| InChIKey | YQBGAEVESYOJRD-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|