C15H22N2O2 — CID 64663497
ethyl 2-(4-methyl-2,3-dihydroquinoxalin-1-yl)butanoate (PubChem CID 64663497) has the molecular formula C15H22N2O2 and a molecular weight of 262.35 g/mol. Its IUPAC name is ethyl 2-(4-methyl-2,3-dihydroquinoxalin-1-yl)butanoate.
| Compound Name | ethyl 2-(4-methyl-2,3-dihydroquinoxalin-1-yl)butanoate |
|---|---|
| PubChem CID | 64663497 |
| Molecular Formula | C15H22N2O2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.17 |
| IUPAC Name | ethyl 2-(4-methyl-2,3-dihydroquinoxalin-1-yl)butanoate |
| SMILES | CCOC(=O)C(CC)N1CCN(C)c2ccccc21 |
| InChI | InChI=1S/C15H22N2O2/c1-4-12(15(18)19-5-2)17-11-10-16(3)13-8-6-7-9-14(13)17/h6-9,12H,4-5,10-11H2,1-3H3 |
| InChIKey | BZWKCVIWOXHTOE-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |