C13H14BrN3O4 — CID 64669403
4-bromo-N-(1-methyl-6-oxopiperidin-3-yl)-3-nitrobenzamide (PubChem CID 64669403) has the molecular formula C13H14BrN3O4 and a molecular weight of 356.18 g/mol. Its IUPAC name is 4-bromo-N-(1-methyl-6-oxopiperidin-3-yl)-3-nitrobenzamide.
| Compound Name | 4-bromo-N-(1-methyl-6-oxopiperidin-3-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 64669403 |
| Molecular Formula | C13H14BrN3O4 |
| Molecular Weight | 356.18 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 4-bromo-N-(1-methyl-6-oxopiperidin-3-yl)-3-nitrobenzamide |
| SMILES | CN1CC(NC(=O)c2ccc(Br)c([N+](=O)[O-])c2)CCC1=O |
| InChI | InChI=1S/C13H14BrN3O4/c1-16-7-9(3-5-12(16)18)15-13(19)8-2-4-10(14)11(6-8)17(20)21/h2,4,6,9H,3,5,7H2,1H3,(H,15,19) |
| InChIKey | LYYLRZPSSYLRRQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.18 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|