C14H22ClNO2S — CID 64674433
3-(3-chlorophenyl)sulfonyl-N-methylheptan-4-amine (PubChem CID 64674433) has the molecular formula C14H22ClNO2S and a molecular weight of 303.85 g/mol. Its IUPAC name is 3-(3-chlorophenyl)sulfonyl-N-methylheptan-4-amine.
| Compound Name | 3-(3-chlorophenyl)sulfonyl-N-methylheptan-4-amine |
|---|---|
| PubChem CID | 64674433 |
| Molecular Formula | C14H22ClNO2S |
| Molecular Weight | 303.85 g/mol |
| Exact Mass | 303.11 |
| IUPAC Name | 3-(3-chlorophenyl)sulfonyl-N-methylheptan-4-amine |
| SMILES | CCCC(NC)C(CC)S(=O)(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C14H22ClNO2S/c1-4-7-13(16-3)14(5-2)19(17,18)12-9-6-8-11(15)10-12/h6,8-10,13-14,16H,4-5,7H2,1-3H3 |
| InChIKey | FIEWNDRHJVEVNP-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.85 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |