C14H21Cl2NO2S — CID 64641228
3-(2,5-dichlorophenyl)sulfonyl-N-methylheptan-4-amine (PubChem CID 64641228) has the molecular formula C14H21Cl2NO2S and a molecular weight of 338.30 g/mol. Its IUPAC name is 3-(2,5-dichlorophenyl)sulfonyl-N-methylheptan-4-amine.
| Compound Name | 3-(2,5-dichlorophenyl)sulfonyl-N-methylheptan-4-amine |
|---|---|
| PubChem CID | 64641228 |
| Molecular Formula | C14H21Cl2NO2S |
| Molecular Weight | 338.30 g/mol |
| Exact Mass | 337.07 |
| IUPAC Name | 3-(2,5-dichlorophenyl)sulfonyl-N-methylheptan-4-amine |
| SMILES | CCCC(NC)C(CC)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C14H21Cl2NO2S/c1-4-6-12(17-3)13(5-2)20(18,19)14-9-10(15)7-8-11(14)16/h7-9,12-13,17H,4-6H2,1-3H3 |
| InChIKey | JTSSWXYKPVIGHA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.30 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |