C15H23Cl2NS — CID 64619681
3-(2,5-dichlorophenyl)sulfanyl-N-ethylheptan-4-amine (PubChem CID 64619681) has the molecular formula C15H23Cl2NS and a molecular weight of 320.33 g/mol. Its IUPAC name is 3-(2,5-dichlorophenyl)sulfanyl-N-ethylheptan-4-amine.
| Compound Name | 3-(2,5-dichlorophenyl)sulfanyl-N-ethylheptan-4-amine |
|---|---|
| PubChem CID | 64619681 |
| Molecular Formula | C15H23Cl2NS |
| Molecular Weight | 320.33 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 3-(2,5-dichlorophenyl)sulfanyl-N-ethylheptan-4-amine |
| SMILES | CCCC(NCC)C(CC)Sc1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C15H23Cl2NS/c1-4-7-13(18-6-3)14(5-2)19-15-10-11(16)8-9-12(15)17/h8-10,13-14,18H,4-7H2,1-3H3 |
| InChIKey | LPBBOOLTPBLYBU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.33 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |