C14H20F3NO2S — CID 64675011
N-ethyl-2-propan-2-ylsulfonyl-1-[3-(trifluoromethyl)phenyl]ethanamine (PubChem CID 64675011) has the molecular formula C14H20F3NO2S and a molecular weight of 323.38 g/mol. Its IUPAC name is N-ethyl-2-propan-2-ylsulfonyl-1-[3-(trifluoromethyl)phenyl]ethanamine.
| Compound Name | N-ethyl-2-propan-2-ylsulfonyl-1-[3-(trifluoromethyl)phenyl]ethanamine |
|---|---|
| PubChem CID | 64675011 |
| Molecular Formula | C14H20F3NO2S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | N-ethyl-2-propan-2-ylsulfonyl-1-[3-(trifluoromethyl)phenyl]ethanamine |
| SMILES | CCNC(CS(=O)(=O)C(C)C)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H20F3NO2S/c1-4-18-13(9-21(19,20)10(2)3)11-6-5-7-12(8-11)14(15,16)17/h5-8,10,13,18H,4,9H2,1-3H3 |
| InChIKey | QPSFRRULJWNYRM-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |