C9H12N4O5S — CID 64680693
5-(4-methyl-3-oxopiperazin-1-yl)sulfonyl-1H-pyrazole-4-carboxylic acid (PubChem CID 64680693) has the molecular formula C9H12N4O5S and a molecular weight of 288.28 g/mol. Its IUPAC name is 5-(4-methyl-3-oxopiperazin-1-yl)sulfonyl-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-(4-methyl-3-oxopiperazin-1-yl)sulfonyl-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 64680693 |
| Molecular Formula | C9H12N4O5S |
| Molecular Weight | 288.28 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | 5-(4-methyl-3-oxopiperazin-1-yl)sulfonyl-1H-pyrazole-4-carboxylic acid |
| SMILES | CN1CCN(S(=O)(=O)c2[nH]ncc2C(=O)O)CC1=O |
| InChI | InChI=1S/C9H12N4O5S/c1-12-2-3-13(5-7(12)14)19(17,18)8-6(9(15)16)4-10-11-8/h4H,2-3,5H2,1H3,(H,10,11)(H,15,16) |
| InChIKey | LEDRAPULCSWGEW-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 123.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.28 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |