C9H11N3O4S — CID 114408294
5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-1H-pyrazole-4-carboxylic acid (PubChem CID 114408294) has the molecular formula C9H11N3O4S and a molecular weight of 257.27 g/mol. Its IUPAC name is 5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-1H-pyrazole-4-carboxylic acid.
| Compound Name | 5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-1H-pyrazole-4-carboxylic acid |
|---|---|
| PubChem CID | 114408294 |
| Molecular Formula | C9H11N3O4S |
| Molecular Weight | 257.27 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 5-(3,6-dihydro-2H-pyridin-1-ylsulfonyl)-1H-pyrazole-4-carboxylic acid |
| SMILES | O=C(O)c1cn[nH]c1S(=O)(=O)N1CC=CCC1 |
| InChI | InChI=1S/C9H11N3O4S/c13-9(14)7-6-10-11-8(7)17(15,16)12-4-2-1-3-5-12/h1-2,6H,3-5H2,(H,10,11)(H,13,14) |
| InChIKey | NSCXHXIYIGNRRH-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 103.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.27 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|