C17H17NO2S — CID 64692712
2-[2-(2,4-dimethylphenyl)sulfinylethoxy]benzonitrile (PubChem CID 64692712) has the molecular formula C17H17NO2S and a molecular weight of 299.40 g/mol. Its IUPAC name is 2-[2-(2,4-dimethylphenyl)sulfinylethoxy]benzonitrile.
| Compound Name | 2-[2-(2,4-dimethylphenyl)sulfinylethoxy]benzonitrile |
|---|---|
| PubChem CID | 64692712 |
| Molecular Formula | C17H17NO2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 2-[2-(2,4-dimethylphenyl)sulfinylethoxy]benzonitrile |
| SMILES | Cc1ccc(S(=O)CCOc2ccccc2C#N)c(C)c1 |
| InChI | InChI=1S/C17H17NO2S/c1-13-7-8-17(14(2)11-13)21(19)10-9-20-16-6-4-3-5-15(16)12-18/h3-8,11H,9-10H2,1-2H3 |
| InChIKey | GWBVCMNTJKFZJJ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |