C10H11ClFNO4S — CID 64695885
4-amino-2-(3-chloro-4-fluorophenyl)sulfonylbutanoic acid (PubChem CID 64695885) has the molecular formula C10H11ClFNO4S and a molecular weight of 295.72 g/mol. Its IUPAC name is 4-amino-2-(3-chloro-4-fluorophenyl)sulfonylbutanoic acid.
| Compound Name | 4-amino-2-(3-chloro-4-fluorophenyl)sulfonylbutanoic acid |
|---|---|
| PubChem CID | 64695885 |
| Molecular Formula | C10H11ClFNO4S |
| Molecular Weight | 295.72 g/mol |
| Exact Mass | 295.01 |
| IUPAC Name | 4-amino-2-(3-chloro-4-fluorophenyl)sulfonylbutanoic acid |
| SMILES | NCCC(C(=O)O)S(=O)(=O)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C10H11ClFNO4S/c11-7-5-6(1-2-8(7)12)18(16,17)9(3-4-13)10(14)15/h1-2,5,9H,3-4,13H2,(H,14,15) |
| InChIKey | WSRUILKHGOINRL-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.72 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |