C9H9ClFNO4S — CID 65443416
2-amino-3-(3-chloro-4-fluorophenyl)sulfonylpropanoic acid (PubChem CID 65443416) has the molecular formula C9H9ClFNO4S and a molecular weight of 281.69 g/mol. Its IUPAC name is 2-amino-3-(3-chloro-4-fluorophenyl)sulfonylpropanoic acid.
| Compound Name | 2-amino-3-(3-chloro-4-fluorophenyl)sulfonylpropanoic acid |
|---|---|
| PubChem CID | 65443416 |
| Molecular Formula | C9H9ClFNO4S |
| Molecular Weight | 281.69 g/mol |
| Exact Mass | 280.99 |
| IUPAC Name | 2-amino-3-(3-chloro-4-fluorophenyl)sulfonylpropanoic acid |
| SMILES | NC(CS(=O)(=O)c1ccc(F)c(Cl)c1)C(=O)O |
| InChI | InChI=1S/C9H9ClFNO4S/c10-6-3-5(1-2-7(6)11)17(15,16)4-8(12)9(13)14/h1-3,8H,4,12H2,(H,13,14) |
| InChIKey | MHSMKFHFOSSACK-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 97.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.69 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |