C17H18Cl2FNO4S — CID 171618095
methyl 3-amino-4-(3-chloro-4-fluorophenyl)sulfonyl-2-phenylbutanoate;hydrochloride (PubChem CID 171618095) has the molecular formula C17H18Cl2FNO4S and a molecular weight of 422.31 g/mol. Its IUPAC name is methyl 3-amino-4-(3-chloro-4-fluorophenyl)sulfonyl-2-phenylbutanoate;hydrochloride.
| Compound Name | methyl 3-amino-4-(3-chloro-4-fluorophenyl)sulfonyl-2-phenylbutanoate;hydrochloride |
|---|---|
| PubChem CID | 171618095 |
| Molecular Formula | C17H18Cl2FNO4S |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 421.03 |
| IUPAC Name | methyl 3-amino-4-(3-chloro-4-fluorophenyl)sulfonyl-2-phenylbutanoate;hydrochloride |
| SMILES | COC(=O)C(c1ccccc1)C(N)CS(=O)(=O)c1ccc(F)c(Cl)c1.Cl |
| InChI | InChI=1S/C17H17ClFNO4S.ClH/c1-24-17(21)16(11-5-3-2-4-6-11)15(20)10-25(22,23)12-7-8-14(19)13(18)9-12;/h2-9,15-16H,10,20H2,1H3;1H |
| InChIKey | BEPCKECCIVXHBF-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |