C16H19N3O4S — CID 6469593
5-methyl-N-(4-piperidin-1-ylsulfonylphenyl)-1,2-oxazole-3-carboxamide (PubChem CID 6469593) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is 5-methyl-N-(4-piperidin-1-ylsulfonylphenyl)-1,2-oxazole-3-carboxamide.
| Compound Name | 5-methyl-N-(4-piperidin-1-ylsulfonylphenyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 6469593 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | 5-methyl-N-(4-piperidin-1-ylsulfonylphenyl)-1,2-oxazole-3-carboxamide |
| SMILES | Cc1cc(C(=O)Nc2ccc(S(=O)(=O)N3CCCCC3)cc2)no1 |
| InChI | InChI=1S/C16H19N3O4S/c1-12-11-15(18-23-12)16(20)17-13-5-7-14(8-6-13)24(21,22)19-9-3-2-4-10-19/h5-8,11H,2-4,9-10H2,1H3,(H,17,20) |
| InChIKey | CECQEFCMCOWJNQ-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |