C18H17Cl4N3O3S — CID 16551770
N-[4-(azepan-1-ylsulfonyl)phenyl]-3,4,5,6-tetrachloropyridine-2-carboxamide (PubChem CID 16551770) has the molecular formula C18H17Cl4N3O3S and a molecular weight of 497.23 g/mol. Its IUPAC name is N-[4-(azepan-1-ylsulfonyl)phenyl]-3,4,5,6-tetrachloropyridine-2-carboxamide.
| Compound Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-3,4,5,6-tetrachloropyridine-2-carboxamide |
|---|---|
| PubChem CID | 16551770 |
| Molecular Formula | C18H17Cl4N3O3S |
| Molecular Weight | 497.23 g/mol |
| Exact Mass | 494.97 |
| IUPAC Name | N-[4-(azepan-1-ylsulfonyl)phenyl]-3,4,5,6-tetrachloropyridine-2-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)N2CCCCCC2)cc1)c1nc(Cl)c(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C18H17Cl4N3O3S/c19-13-14(20)16(24-17(22)15(13)21)18(26)23-11-5-7-12(8-6-11)29(27,28)25-9-3-1-2-4-10-25/h5-8H,1-4,9-10H2,(H,23,26) |
| InChIKey | ZUHMFKLNPDHIMD-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.23 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|