C10H11ClF3NO2S — CID 64697153
3-(4-chlorophenyl)sulfonyl-4,4,4-trifluorobutan-1-amine (PubChem CID 64697153) has the molecular formula C10H11ClF3NO2S and a molecular weight of 301.72 g/mol. Its IUPAC name is 3-(4-chlorophenyl)sulfonyl-4,4,4-trifluorobutan-1-amine.
| Compound Name | 3-(4-chlorophenyl)sulfonyl-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 64697153 |
| Molecular Formula | C10H11ClF3NO2S |
| Molecular Weight | 301.72 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 3-(4-chlorophenyl)sulfonyl-4,4,4-trifluorobutan-1-amine |
| SMILES | NCCC(C(F)(F)F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C10H11ClF3NO2S/c11-7-1-3-8(4-2-7)18(16,17)9(5-6-15)10(12,13)14/h1-4,9H,5-6,15H2 |
| InChIKey | RPXULNBNDDIPAZ-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.72 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |