C14H20F3NO2S — CID 64697396
3-(4-tert-butylphenyl)sulfonyl-4,4,4-trifluorobutan-1-amine (PubChem CID 64697396) has the molecular formula C14H20F3NO2S and a molecular weight of 323.38 g/mol. Its IUPAC name is 3-(4-tert-butylphenyl)sulfonyl-4,4,4-trifluorobutan-1-amine.
| Compound Name | 3-(4-tert-butylphenyl)sulfonyl-4,4,4-trifluorobutan-1-amine |
|---|---|
| PubChem CID | 64697396 |
| Molecular Formula | C14H20F3NO2S |
| Molecular Weight | 323.38 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 3-(4-tert-butylphenyl)sulfonyl-4,4,4-trifluorobutan-1-amine |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)C(CCN)C(F)(F)F)cc1 |
| InChI | InChI=1S/C14H20F3NO2S/c1-13(2,3)10-4-6-11(7-5-10)21(19,20)12(8-9-18)14(15,16)17/h4-7,12H,8-9,18H2,1-3H3 |
| InChIKey | CAFUGRAGBUAPDW-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.38 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |