C15H12N2O5 — CID 6469762
1,3-bis(1,3-benzodioxol-5-yl)urea (PubChem CID 6469762) has the molecular formula C15H12N2O5 and a molecular weight of 300.27 g/mol. Its IUPAC name is 1,3-bis(1,3-benzodioxol-5-yl)urea.
| Compound Name | 1,3-bis(1,3-benzodioxol-5-yl)urea |
|---|---|
| PubChem CID | 6469762 |
| Molecular Formula | C15H12N2O5 |
| Molecular Weight | 300.27 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 1,3-bis(1,3-benzodioxol-5-yl)urea |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H12N2O5/c18-15(16-9-1-3-11-13(5-9)21-7-19-11)17-10-2-4-12-14(6-10)22-8-20-12/h1-6H,7-8H2,(H2,16,17,18) |
| InChIKey | SFNUQOFRUOOFRC-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.27 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |