C13H12F2N2O2S — CID 64698646
[3-[(2,5-difluorophenyl)sulfonylmethyl]-2-pyridinyl]methanamine (PubChem CID 64698646) has the molecular formula C13H12F2N2O2S and a molecular weight of 298.31 g/mol. Its IUPAC name is [3-[(2,5-difluorophenyl)sulfonylmethyl]-2-pyridinyl]methanamine.
| Compound Name | [3-[(2,5-difluorophenyl)sulfonylmethyl]-2-pyridinyl]methanamine |
|---|---|
| PubChem CID | 64698646 |
| Molecular Formula | C13H12F2N2O2S |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.06 |
| IUPAC Name | [3-[(2,5-difluorophenyl)sulfonylmethyl]-2-pyridinyl]methanamine |
| SMILES | NCc1ncccc1CS(=O)(=O)c1cc(F)ccc1F |
| InChI | InChI=1S/C13H12F2N2O2S/c14-10-3-4-11(15)13(6-10)20(18,19)8-9-2-1-5-17-12(9)7-16/h1-6H,7-8,16H2 |
| InChIKey | WOPVBYDEXKCAPS-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |