C7H14F3NO2S — CID 64699235
4,4,4-trifluoro-3-propylsulfonylbutan-1-amine (PubChem CID 64699235) has the molecular formula C7H14F3NO2S and a molecular weight of 233.25 g/mol. Its IUPAC name is 4,4,4-trifluoro-3-propylsulfonylbutan-1-amine.
| Compound Name | 4,4,4-trifluoro-3-propylsulfonylbutan-1-amine |
|---|---|
| PubChem CID | 64699235 |
| Molecular Formula | C7H14F3NO2S |
| Molecular Weight | 233.25 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 4,4,4-trifluoro-3-propylsulfonylbutan-1-amine |
| SMILES | CCCS(=O)(=O)C(CCN)C(F)(F)F |
| InChI | InChI=1S/C7H14F3NO2S/c1-2-5-14(12,13)6(3-4-11)7(8,9)10/h6H,2-5,11H2,1H3 |
| InChIKey | RSXRFBHACBABRT-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.25 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |