C14H21F2NS — CID 64702656
4-(2,4-difluorophenyl)sulfanyl-N-propylpentan-2-amine (PubChem CID 64702656) has the molecular formula C14H21F2NS and a molecular weight of 273.39 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)sulfanyl-N-propylpentan-2-amine.
| Compound Name | 4-(2,4-difluorophenyl)sulfanyl-N-propylpentan-2-amine |
|---|---|
| PubChem CID | 64702656 |
| Molecular Formula | C14H21F2NS |
| Molecular Weight | 273.39 g/mol |
| Exact Mass | 273.14 |
| IUPAC Name | 4-(2,4-difluorophenyl)sulfanyl-N-propylpentan-2-amine |
| SMILES | CCCNC(C)CC(C)Sc1ccc(F)cc1F |
| InChI | InChI=1S/C14H21F2NS/c1-4-7-17-10(2)8-11(3)18-14-6-5-12(15)9-13(14)16/h5-6,9-11,17H,4,7-8H2,1-3H3 |
| InChIKey | YXLSGRRNOFIECJ-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.39 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |