C13H19F2NS — CID 55092288
N-[2-(2,4-difluorophenyl)sulfanylpropyl]butan-2-amine (PubChem CID 55092288) has the molecular formula C13H19F2NS and a molecular weight of 259.37 g/mol. Its IUPAC name is N-[2-(2,4-difluorophenyl)sulfanylpropyl]butan-2-amine.
| Compound Name | N-[2-(2,4-difluorophenyl)sulfanylpropyl]butan-2-amine |
|---|---|
| PubChem CID | 55092288 |
| Molecular Formula | C13H19F2NS |
| Molecular Weight | 259.37 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | N-[2-(2,4-difluorophenyl)sulfanylpropyl]butan-2-amine |
| SMILES | CCC(C)NCC(C)Sc1ccc(F)cc1F |
| InChI | InChI=1S/C13H19F2NS/c1-4-9(2)16-8-10(3)17-13-6-5-11(14)7-12(13)15/h5-7,9-10,16H,4,8H2,1-3H3 |
| InChIKey | NICHTJQBWNXVFY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.37 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |