C14H30N2O3 — CID 64703757
methyl 2-(ethylamino)-4-[3-methoxypropyl(methyl)amino]-2-methylpentanoate (PubChem CID 64703757) has the molecular formula C14H30N2O3 and a molecular weight of 274.40 g/mol. Its IUPAC name is methyl 2-(ethylamino)-4-[3-methoxypropyl(methyl)amino]-2-methylpentanoate.
| Compound Name | methyl 2-(ethylamino)-4-[3-methoxypropyl(methyl)amino]-2-methylpentanoate |
|---|---|
| PubChem CID | 64703757 |
| Molecular Formula | C14H30N2O3 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | methyl 2-(ethylamino)-4-[3-methoxypropyl(methyl)amino]-2-methylpentanoate |
| SMILES | CCNC(C)(CC(C)N(C)CCCOC)C(=O)OC |
| InChI | InChI=1S/C14H30N2O3/c1-7-15-14(3,13(17)19-6)11-12(2)16(4)9-8-10-18-5/h12,15H,7-11H2,1-6H3 |
| InChIKey | MHLHXCMSNITTGZ-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|