C12H21N5O2S — CID 64709347
4-(1-cyclopropyltetrazol-5-yl)sulfanyl-2-(ethylamino)-2-methylpentanoic acid (PubChem CID 64709347) has the molecular formula C12H21N5O2S and a molecular weight of 299.40 g/mol. Its IUPAC name is 4-(1-cyclopropyltetrazol-5-yl)sulfanyl-2-(ethylamino)-2-methylpentanoic acid.
| Compound Name | 4-(1-cyclopropyltetrazol-5-yl)sulfanyl-2-(ethylamino)-2-methylpentanoic acid |
|---|---|
| PubChem CID | 64709347 |
| Molecular Formula | C12H21N5O2S |
| Molecular Weight | 299.40 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | 4-(1-cyclopropyltetrazol-5-yl)sulfanyl-2-(ethylamino)-2-methylpentanoic acid |
| SMILES | CCNC(C)(CC(C)Sc1nnnn1C1CC1)C(=O)O |
| InChI | InChI=1S/C12H21N5O2S/c1-4-13-12(3,10(18)19)7-8(2)20-11-14-15-16-17(11)9-5-6-9/h8-9,13H,4-7H2,1-3H3,(H,18,19) |
| InChIKey | XINKPTSHFOSYNW-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.40 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |