C12H21N3O2S — CID 64710646
2-(ethylamino)-2-methyl-4-(1-methylimidazol-2-yl)sulfanylpentanoic acid (PubChem CID 64710646) has the molecular formula C12H21N3O2S and a molecular weight of 271.39 g/mol. Its IUPAC name is 2-(ethylamino)-2-methyl-4-(1-methylimidazol-2-yl)sulfanylpentanoic acid.
| Compound Name | 2-(ethylamino)-2-methyl-4-(1-methylimidazol-2-yl)sulfanylpentanoic acid |
|---|---|
| PubChem CID | 64710646 |
| Molecular Formula | C12H21N3O2S |
| Molecular Weight | 271.39 g/mol |
| Exact Mass | 271.14 |
| IUPAC Name | 2-(ethylamino)-2-methyl-4-(1-methylimidazol-2-yl)sulfanylpentanoic acid |
| SMILES | CCNC(C)(CC(C)Sc1nccn1C)C(=O)O |
| InChI | InChI=1S/C12H21N3O2S/c1-5-14-12(3,10(16)17)8-9(2)18-11-13-6-7-15(11)4/h6-7,9,14H,5,8H2,1-4H3,(H,16,17) |
| InChIKey | FIAQNQKFMGFZPB-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |