C15H31N3O2 — CID 64709909
methyl 2-amino-4-(4-tert-butylpiperazin-1-yl)-2-methylpentanoate (PubChem CID 64709909) has the molecular formula C15H31N3O2 and a molecular weight of 285.43 g/mol. Its IUPAC name is methyl 2-amino-4-(4-tert-butylpiperazin-1-yl)-2-methylpentanoate.
| Compound Name | methyl 2-amino-4-(4-tert-butylpiperazin-1-yl)-2-methylpentanoate |
|---|---|
| PubChem CID | 64709909 |
| Molecular Formula | C15H31N3O2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.24 |
| IUPAC Name | methyl 2-amino-4-(4-tert-butylpiperazin-1-yl)-2-methylpentanoate |
| SMILES | COC(=O)C(C)(N)CC(C)N1CCN(C(C)(C)C)CC1 |
| InChI | InChI=1S/C15H31N3O2/c1-12(11-15(5,16)13(19)20-6)17-7-9-18(10-8-17)14(2,3)4/h12H,7-11,16H2,1-6H3 |
| InChIKey | XJXUVIHEOGHCLN-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |