C14H29N3O2 — CID 64712123
methyl 2-amino-4-[4-(dimethylamino)piperidin-1-yl]-2-methylpentanoate (PubChem CID 64712123) has the molecular formula C14H29N3O2 and a molecular weight of 271.40 g/mol. Its IUPAC name is methyl 2-amino-4-[4-(dimethylamino)piperidin-1-yl]-2-methylpentanoate.
| Compound Name | methyl 2-amino-4-[4-(dimethylamino)piperidin-1-yl]-2-methylpentanoate |
|---|---|
| PubChem CID | 64712123 |
| Molecular Formula | C14H29N3O2 |
| Molecular Weight | 271.40 g/mol |
| Exact Mass | 271.23 |
| IUPAC Name | methyl 2-amino-4-[4-(dimethylamino)piperidin-1-yl]-2-methylpentanoate |
| SMILES | COC(=O)C(C)(N)CC(C)N1CCC(N(C)C)CC1 |
| InChI | InChI=1S/C14H29N3O2/c1-11(10-14(2,15)13(18)19-5)17-8-6-12(7-9-17)16(3)4/h11-12H,6-10,15H2,1-5H3 |
| InChIKey | KVPCJGONAILABU-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.40 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |