About 3-bromo-4-(3,5-dimethylphenyl)pentan-2-one
3-bromo-4-(3,5-dimethylphenyl)pentan-2-one (PubChem CID 64718935) has the molecular formula C13H17BrO
and a molecular weight of 269.18 g/mol. Its IUPAC name is 3-bromo-4-(3,5-dimethylphenyl)pentan-2-one.
Molecular Properties
| Compound Name | 3-bromo-4-(3,5-dimethylphenyl)pentan-2-one |
| PubChem CID | 64718935 |
| Molecular Formula | C13H17BrO |
| Molecular Weight | 269.18 g/mol |
| Exact Mass | 268.05 |
| IUPAC Name | 3-bromo-4-(3,5-dimethylphenyl)pentan-2-one |
| SMILES | CC(=O)C(Br)C(C)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C13H17BrO/c1-8-5-9(2)7-12(6-8)10(3)13(14)11(4)15/h5-7,10,13H,1-4H3 |
| InChIKey | PAOOGMSTWMGXHF-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.18 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-4-(3,5-dimethylphenyl)pentan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-4-(3,5-dimethylphenyl)pentan-2-one?
The IUPAC name of 3-bromo-4-(3,5-dimethylphenyl)pentan-2-one (CID 64718935) is 3-bromo-4-(3,5-dimethylphenyl)pentan-2-one.
What is the SMILES notation for 3-bromo-4-(3,5-dimethylphenyl)pentan-2-one?
The canonical SMILES for 3-bromo-4-(3,5-dimethylphenyl)pentan-2-one is CC(=O)C(Br)C(C)c1cc(C)cc(C)c1.
What is the InChIKey of 3-bromo-4-(3,5-dimethylphenyl)pentan-2-one?
The InChIKey is PAOOGMSTWMGXHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17BrO/c1-8-5-9(2)7-12(6-8)10(3)13(14)11(4)15/h5-7,10,13H,1-4H3.
What are the key properties of 3-bromo-4-(3,5-dimethylphenyl)pentan-2-one?
3-bromo-4-(3,5-dimethylphenyl)pentan-2-one has a molecular weight of 269.18 g/mol, XLogP of 3.76, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-4-(3,5-dimethylphenyl)pentan-2-one is sourced from PubChem (CID 64718935), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).