C15H14Br2N2O2 — CID 64720406
4-amino-3-(2,4-dibromophenoxy)-N,N-dimethylbenzamide (PubChem CID 64720406) has the molecular formula C15H14Br2N2O2 and a molecular weight of 414.10 g/mol. Its IUPAC name is 4-amino-3-(2,4-dibromophenoxy)-N,N-dimethylbenzamide.
| Compound Name | 4-amino-3-(2,4-dibromophenoxy)-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 64720406 |
| Molecular Formula | C15H14Br2N2O2 |
| Molecular Weight | 414.10 g/mol |
| Exact Mass | 411.94 |
| IUPAC Name | 4-amino-3-(2,4-dibromophenoxy)-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(N)c(Oc2ccc(Br)cc2Br)c1 |
| InChI | InChI=1S/C15H14Br2N2O2/c1-19(2)15(20)9-3-5-12(18)14(7-9)21-13-6-4-10(16)8-11(13)17/h3-8H,18H2,1-2H3 |
| InChIKey | KKWFCQUFDLZFQO-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.10 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|