C14H25Br — CID 64728555
1-(3-bromo-3-cyclopropylpropyl)-3,5-dimethylcyclohexane (PubChem CID 64728555) has the molecular formula C14H25Br and a molecular weight of 273.26 g/mol. Its IUPAC name is 1-(3-bromo-3-cyclopropylpropyl)-3,5-dimethylcyclohexane.
| Compound Name | 1-(3-bromo-3-cyclopropylpropyl)-3,5-dimethylcyclohexane |
|---|---|
| PubChem CID | 64728555 |
| Molecular Formula | C14H25Br |
| Molecular Weight | 273.26 g/mol |
| Exact Mass | 272.11 |
| IUPAC Name | 1-(3-bromo-3-cyclopropylpropyl)-3,5-dimethylcyclohexane |
| SMILES | CC1CC(C)CC(CCC(Br)C2CC2)C1 |
| InChI | InChI=1S/C14H25Br/c1-10-7-11(2)9-12(8-10)3-6-14(15)13-4-5-13/h10-14H,3-9H2,1-2H3 |
| InChIKey | PFMSEANUSHAAPL-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.26 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|