C14H21NO2S — CID 64729332
2-(3,5-dimethylcyclohexyl)sulfonylaniline (PubChem CID 64729332) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 2-(3,5-dimethylcyclohexyl)sulfonylaniline.
| Compound Name | 2-(3,5-dimethylcyclohexyl)sulfonylaniline |
|---|---|
| PubChem CID | 64729332 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 2-(3,5-dimethylcyclohexyl)sulfonylaniline |
| SMILES | CC1CC(C)CC(S(=O)(=O)c2ccccc2N)C1 |
| InChI | InChI=1S/C14H21NO2S/c1-10-7-11(2)9-12(8-10)18(16,17)14-6-4-3-5-13(14)15/h3-6,10-12H,7-9,15H2,1-2H3 |
| InChIKey | WAHVRHVKRQEKIM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|