C14H20ClNO2S — CID 81175102
5-chloro-2-(3,5-dimethylcyclohexyl)sulfonylaniline (PubChem CID 81175102) has the molecular formula C14H20ClNO2S and a molecular weight of 301.84 g/mol. Its IUPAC name is 5-chloro-2-(3,5-dimethylcyclohexyl)sulfonylaniline.
| Compound Name | 5-chloro-2-(3,5-dimethylcyclohexyl)sulfonylaniline |
|---|---|
| PubChem CID | 81175102 |
| Molecular Formula | C14H20ClNO2S |
| Molecular Weight | 301.84 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 5-chloro-2-(3,5-dimethylcyclohexyl)sulfonylaniline |
| SMILES | CC1CC(C)CC(S(=O)(=O)c2ccc(Cl)cc2N)C1 |
| InChI | InChI=1S/C14H20ClNO2S/c1-9-5-10(2)7-12(6-9)19(17,18)14-4-3-11(15)8-13(14)16/h3-4,8-10,12H,5-7,16H2,1-2H3 |
| InChIKey | OOICVCQTJFINKE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.84 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|