About 5-chloro-2-(3,5-dimethylcyclohexyl)sulfonylaniline
5-chloro-2-(3,5-dimethylcyclohexyl)sulfonylaniline (PubChem CID 81175102) has the molecular formula C14H20ClNO2S
and a molecular weight of 301.84 g/mol. Its IUPAC name is 5-chloro-2-(3,5-dimethylcyclohexyl)sulfonylaniline.
Molecular Properties
| Compound Name | 5-chloro-2-(3,5-dimethylcyclohexyl)sulfonylaniline |
| PubChem CID | 81175102 |
| Molecular Formula | C14H20ClNO2S |
| Molecular Weight | 301.84 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | 5-chloro-2-(3,5-dimethylcyclohexyl)sulfonylaniline |
| SMILES | CC1CC(C)CC(S(=O)(=O)c2ccc(Cl)cc2N)C1 |
| InChI | InChI=1S/C14H20ClNO2S/c1-9-5-10(2)7-12(6-9)19(17,18)14-4-3-11(15)8-13(14)16/h3-4,8-10,12H,5-7,16H2,1-2H3 |
| InChIKey | OOICVCQTJFINKE-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.84 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-2-(3,5-dimethylcyclohexyl)sulfonylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-2-(3,5-dimethylcyclohexyl)sulfonylaniline?
The IUPAC name of 5-chloro-2-(3,5-dimethylcyclohexyl)sulfonylaniline (CID 81175102) is 5-chloro-2-(3,5-dimethylcyclohexyl)sulfonylaniline.
What is the SMILES notation for 5-chloro-2-(3,5-dimethylcyclohexyl)sulfonylaniline?
The canonical SMILES for 5-chloro-2-(3,5-dimethylcyclohexyl)sulfonylaniline is CC1CC(C)CC(S(=O)(=O)c2ccc(Cl)cc2N)C1.
What is the InChIKey of 5-chloro-2-(3,5-dimethylcyclohexyl)sulfonylaniline?
The InChIKey is OOICVCQTJFINKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClNO2S/c1-9-5-10(2)7-12(6-9)19(17,18)14-4-3-11(15)8-13(14)16/h3-4,8-10,12H,5-7,16H2,1-2H3.
What are the key properties of 5-chloro-2-(3,5-dimethylcyclohexyl)sulfonylaniline?
5-chloro-2-(3,5-dimethylcyclohexyl)sulfonylaniline has a molecular weight of 301.84 g/mol, XLogP of 3.52, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-2-(3,5-dimethylcyclohexyl)sulfonylaniline is sourced from PubChem (CID 81175102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).