C13H18FNO2S — CID 81183010
4-fluoro-2-(3-methylcyclohexyl)sulfonylaniline (PubChem CID 81183010) has the molecular formula C13H18FNO2S and a molecular weight of 271.36 g/mol. Its IUPAC name is 4-fluoro-2-(3-methylcyclohexyl)sulfonylaniline.
| Compound Name | 4-fluoro-2-(3-methylcyclohexyl)sulfonylaniline |
|---|---|
| PubChem CID | 81183010 |
| Molecular Formula | C13H18FNO2S |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 4-fluoro-2-(3-methylcyclohexyl)sulfonylaniline |
| SMILES | CC1CCCC(S(=O)(=O)c2cc(F)ccc2N)C1 |
| InChI | InChI=1S/C13H18FNO2S/c1-9-3-2-4-11(7-9)18(16,17)13-8-10(14)5-6-12(13)15/h5-6,8-9,11H,2-4,7,15H2,1H3 |
| InChIKey | WDMGNNBUQWDRFQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|