C12H25NO4S — CID 64729428
2-[2-(3,5-dimethylcyclohexyl)oxyethoxy]ethanesulfonamide (PubChem CID 64729428) has the molecular formula C12H25NO4S and a molecular weight of 279.40 g/mol. Its IUPAC name is 2-[2-(3,5-dimethylcyclohexyl)oxyethoxy]ethanesulfonamide.
| Compound Name | 2-[2-(3,5-dimethylcyclohexyl)oxyethoxy]ethanesulfonamide |
|---|---|
| PubChem CID | 64729428 |
| Molecular Formula | C12H25NO4S |
| Molecular Weight | 279.40 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-[2-(3,5-dimethylcyclohexyl)oxyethoxy]ethanesulfonamide |
| SMILES | CC1CC(C)CC(OCCOCCS(N)(=O)=O)C1 |
| InChI | InChI=1S/C12H25NO4S/c1-10-7-11(2)9-12(8-10)17-4-3-16-5-6-18(13,14)15/h10-12H,3-9H2,1-2H3,(H2,13,14,15) |
| InChIKey | DFNZPRIWXHGTND-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.40 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|