C13H25NO5 — CID 170420294
N-(1,3-dihydroxypropan-2-yl)-3-[2-(3-methylcyclobutyl)oxyethoxy]propanamide (PubChem CID 170420294) has the molecular formula C13H25NO5 and a molecular weight of 275.34 g/mol. Its IUPAC name is N-(1,3-dihydroxypropan-2-yl)-3-[2-(3-methylcyclobutyl)oxyethoxy]propanamide.
| Compound Name | N-(1,3-dihydroxypropan-2-yl)-3-[2-(3-methylcyclobutyl)oxyethoxy]propanamide |
|---|---|
| PubChem CID | 170420294 |
| Molecular Formula | C13H25NO5 |
| Molecular Weight | 275.34 g/mol |
| Exact Mass | 275.17 |
| IUPAC Name | N-(1,3-dihydroxypropan-2-yl)-3-[2-(3-methylcyclobutyl)oxyethoxy]propanamide |
| SMILES | CC1CC(OCCOCCC(=O)NC(CO)CO)C1 |
| InChI | InChI=1S/C13H25NO5/c1-10-6-12(7-10)19-5-4-18-3-2-13(17)14-11(8-15)9-16/h10-12,15-16H,2-9H2,1H3,(H,14,17) |
| InChIKey | GMSFODQJAKGERN-UHFFFAOYSA-N |
| XLogP | -0.32 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.34 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|