C21H41NO5 — CID 71415512
9-(3-ethoxypropanoylamino)-16-hydroxyhexadecanoic acid (PubChem CID 71415512) has the molecular formula C21H41NO5 and a molecular weight of 387.56 g/mol. Its IUPAC name is 9-(3-ethoxypropanoylamino)-16-hydroxyhexadecanoic acid.
| Compound Name | 9-(3-ethoxypropanoylamino)-16-hydroxyhexadecanoic acid |
|---|---|
| PubChem CID | 71415512 |
| Molecular Formula | C21H41NO5 |
| Molecular Weight | 387.56 g/mol |
| Exact Mass | 387.30 |
| IUPAC Name | 9-(3-ethoxypropanoylamino)-16-hydroxyhexadecanoic acid |
| SMILES | CCOCCC(=O)NC(CCCCCCCO)CCCCCCCC(=O)O |
| InChI | InChI=1S/C21H41NO5/c1-2-27-18-16-20(24)22-19(14-10-6-4-8-12-17-23)13-9-5-3-7-11-15-21(25)26/h19,23H,2-18H2,1H3,(H,22,24)(H,25,26) |
| InChIKey | YVYKAOGZDSSNEY-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|