C16H28N4O6 — CID 176815937
6-(6-azidohexanoylamino)-7-(2-carboxyethoxy)heptanoic acid (PubChem CID 176815937) has the molecular formula C16H28N4O6 and a molecular weight of 372.42 g/mol. Its IUPAC name is 6-(6-azidohexanoylamino)-7-(2-carboxyethoxy)heptanoic acid.
| Compound Name | 6-(6-azidohexanoylamino)-7-(2-carboxyethoxy)heptanoic acid |
|---|---|
| PubChem CID | 176815937 |
| Molecular Formula | C16H28N4O6 |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.20 |
| IUPAC Name | 6-(6-azidohexanoylamino)-7-(2-carboxyethoxy)heptanoic acid |
| SMILES | [N-]=[N+]=NCCCCCC(=O)NC(CCCCC(=O)O)COCCC(=O)O |
| InChI | InChI=1S/C16H28N4O6/c17-20-18-10-5-1-2-7-14(21)19-13(6-3-4-8-15(22)23)12-26-11-9-16(24)25/h13H,1-12H2,(H,19,21)(H,22,23)(H,24,25) |
| InChIKey | HYUSKBDPOSYXDS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 161.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|