C16H30N8O4 — CID 59248185
4-azido-N-[1-[2-[2-(4-azidobutanoylamino)propoxy]ethoxy]propan-2-yl]butanamide (PubChem CID 59248185) has the molecular formula C16H30N8O4 and a molecular weight of 398.47 g/mol. Its IUPAC name is 4-azido-N-[1-[2-[2-(4-azidobutanoylamino)propoxy]ethoxy]propan-2-yl]butanamide.
| Compound Name | 4-azido-N-[1-[2-[2-(4-azidobutanoylamino)propoxy]ethoxy]propan-2-yl]butanamide |
|---|---|
| PubChem CID | 59248185 |
| Molecular Formula | C16H30N8O4 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | 4-azido-N-[1-[2-[2-(4-azidobutanoylamino)propoxy]ethoxy]propan-2-yl]butanamide |
| SMILES | CC(COCCOCC(C)NC(=O)CCCN=[N+]=[N-])NC(=O)CCCN=[N+]=[N-] |
| InChI | InChI=1S/C16H30N8O4/c1-13(21-15(25)5-3-7-19-23-17)11-27-9-10-28-12-14(2)22-16(26)6-4-8-20-24-18/h13-14H,3-12H2,1-2H3,(H,21,25)(H,22,26) |
| InChIKey | UEVMXNGTIMLLBX-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 174.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|