C12H19N — CID 64729748
1-(3,5-dimethylcyclohexyl)pyrrole (PubChem CID 64729748) has the molecular formula C12H19N and a molecular weight of 177.29 g/mol. Its IUPAC name is 1-(3,5-dimethylcyclohexyl)pyrrole.
| Compound Name | 1-(3,5-dimethylcyclohexyl)pyrrole |
|---|---|
| PubChem CID | 64729748 |
| Molecular Formula | C12H19N |
| Molecular Weight | 177.29 g/mol |
| Exact Mass | 177.15 |
| IUPAC Name | 1-(3,5-dimethylcyclohexyl)pyrrole |
| SMILES | CC1CC(C)CC(n2cccc2)C1 |
| InChI | InChI=1S/C12H19N/c1-10-7-11(2)9-12(8-10)13-5-3-4-6-13/h3-6,10-12H,7-9H2,1-2H3 |
| InChIKey | BKZIBZYIYJLCKC-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 4.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.29 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |