C20H33N — CID 64732806
N-(3,4-dimethylcyclohexyl)-2,4-di(propan-2-yl)aniline (PubChem CID 64732806) has the molecular formula C20H33N and a molecular weight of 287.49 g/mol. Its IUPAC name is N-(3,4-dimethylcyclohexyl)-2,4-di(propan-2-yl)aniline.
| Compound Name | N-(3,4-dimethylcyclohexyl)-2,4-di(propan-2-yl)aniline |
|---|---|
| PubChem CID | 64732806 |
| Molecular Formula | C20H33N |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.26 |
| IUPAC Name | N-(3,4-dimethylcyclohexyl)-2,4-di(propan-2-yl)aniline |
| SMILES | CC(C)c1ccc(NC2CCC(C)C(C)C2)c(C(C)C)c1 |
| InChI | InChI=1S/C20H33N/c1-13(2)17-8-10-20(19(12-17)14(3)4)21-18-9-7-15(5)16(6)11-18/h8,10,12-16,18,21H,7,9,11H2,1-6H3 |
| InChIKey | FFWNSYASMRVFIF-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |