About N-cyclohexyl-2,5-di(propan-2-yl)aniline
N-cyclohexyl-2,5-di(propan-2-yl)aniline (PubChem CID 170213032) has the molecular formula C18H29N
and a molecular weight of 259.44 g/mol. Its IUPAC name is N-cyclohexyl-2,5-di(propan-2-yl)aniline.
Molecular Properties
| Compound Name | N-cyclohexyl-2,5-di(propan-2-yl)aniline |
| PubChem CID | 170213032 |
| Molecular Formula | C18H29N |
| Molecular Weight | 259.44 g/mol |
| Exact Mass | 259.23 |
| IUPAC Name | N-cyclohexyl-2,5-di(propan-2-yl)aniline |
| SMILES | CC(C)c1ccc(C(C)C)c(NC2CCCCC2)c1 |
| InChI | InChI=1S/C18H29N/c1-13(2)15-10-11-17(14(3)4)18(12-15)19-16-8-6-5-7-9-16/h10-14,16,19H,5-9H2,1-4H3 |
| InChIKey | MLFCYWGLLAVYKW-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 259.44 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-cyclohexyl-2,5-di(propan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-2,5-di(propan-2-yl)aniline?
The IUPAC name of N-cyclohexyl-2,5-di(propan-2-yl)aniline (CID 170213032) is N-cyclohexyl-2,5-di(propan-2-yl)aniline.
What is the SMILES notation for N-cyclohexyl-2,5-di(propan-2-yl)aniline?
The canonical SMILES for N-cyclohexyl-2,5-di(propan-2-yl)aniline is CC(C)c1ccc(C(C)C)c(NC2CCCCC2)c1.
What is the InChIKey of N-cyclohexyl-2,5-di(propan-2-yl)aniline?
The InChIKey is MLFCYWGLLAVYKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H29N/c1-13(2)15-10-11-17(14(3)4)18(12-15)19-16-8-6-5-7-9-16/h10-14,16,19H,5-9H2,1-4H3.
What are the key properties of N-cyclohexyl-2,5-di(propan-2-yl)aniline?
N-cyclohexyl-2,5-di(propan-2-yl)aniline has a molecular weight of 259.44 g/mol, XLogP of 5.68, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-2,5-di(propan-2-yl)aniline is sourced from PubChem (CID 170213032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).