C22H28ClN3O — CID 50881614
N-[4-amino-2-chloro-5-(cyclohexylamino)phenyl]-4-propan-2-ylbenzamide (PubChem CID 50881614) has the molecular formula C22H28ClN3O and a molecular weight of 385.94 g/mol. Its IUPAC name is N-[4-amino-2-chloro-5-(cyclohexylamino)phenyl]-4-propan-2-ylbenzamide.
| Compound Name | N-[4-amino-2-chloro-5-(cyclohexylamino)phenyl]-4-propan-2-ylbenzamide |
|---|---|
| PubChem CID | 50881614 |
| Molecular Formula | C22H28ClN3O |
| Molecular Weight | 385.94 g/mol |
| Exact Mass | 385.19 |
| IUPAC Name | N-[4-amino-2-chloro-5-(cyclohexylamino)phenyl]-4-propan-2-ylbenzamide |
| SMILES | CC(C)c1ccc(C(=O)Nc2cc(NC3CCCCC3)c(N)cc2Cl)cc1 |
| InChI | InChI=1S/C22H28ClN3O/c1-14(2)15-8-10-16(11-9-15)22(27)26-20-13-21(19(24)12-18(20)23)25-17-6-4-3-5-7-17/h8-14,17,25H,3-7,24H2,1-2H3,(H,26,27) |
| InChIKey | YCHDGKXSJFVMPV-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.94 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|