C18H27BrO2 — CID 64737684
1-(bromomethyl)-2-(3,5-dimethylcyclohexyl)oxy-4-propoxybenzene (PubChem CID 64737684) has the molecular formula C18H27BrO2 and a molecular weight of 355.32 g/mol. Its IUPAC name is 1-(bromomethyl)-2-(3,5-dimethylcyclohexyl)oxy-4-propoxybenzene.
| Compound Name | 1-(bromomethyl)-2-(3,5-dimethylcyclohexyl)oxy-4-propoxybenzene |
|---|---|
| PubChem CID | 64737684 |
| Molecular Formula | C18H27BrO2 |
| Molecular Weight | 355.32 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 1-(bromomethyl)-2-(3,5-dimethylcyclohexyl)oxy-4-propoxybenzene |
| SMILES | CCCOc1ccc(CBr)c(OC2CC(C)CC(C)C2)c1 |
| InChI | InChI=1S/C18H27BrO2/c1-4-7-20-16-6-5-15(12-19)18(11-16)21-17-9-13(2)8-14(3)10-17/h5-6,11,13-14,17H,4,7-10,12H2,1-3H3 |
| InChIKey | MQAIAXQOWAMRAP-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.32 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|