C13H21NO3 — CID 64742373
1-[(3,4-dimethylcyclohexyl)carbamoyl]cyclopropane-1-carboxylic acid (PubChem CID 64742373) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 1-[(3,4-dimethylcyclohexyl)carbamoyl]cyclopropane-1-carboxylic acid.
| Compound Name | 1-[(3,4-dimethylcyclohexyl)carbamoyl]cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 64742373 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 1-[(3,4-dimethylcyclohexyl)carbamoyl]cyclopropane-1-carboxylic acid |
| SMILES | CC1CCC(NC(=O)C2(C(=O)O)CC2)CC1C |
| InChI | InChI=1S/C13H21NO3/c1-8-3-4-10(7-9(8)2)14-11(15)13(5-6-13)12(16)17/h8-10H,3-7H2,1-2H3,(H,14,15)(H,16,17) |
| InChIKey | QMMMRURJDPJABN-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|