C16H23ClO2 — CID 64749126
4-(chloromethyl)-2-(4-ethylcyclohexyl)oxy-1-methoxybenzene (PubChem CID 64749126) has the molecular formula C16H23ClO2 and a molecular weight of 282.81 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(4-ethylcyclohexyl)oxy-1-methoxybenzene.
| Compound Name | 4-(chloromethyl)-2-(4-ethylcyclohexyl)oxy-1-methoxybenzene |
|---|---|
| PubChem CID | 64749126 |
| Molecular Formula | C16H23ClO2 |
| Molecular Weight | 282.81 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 4-(chloromethyl)-2-(4-ethylcyclohexyl)oxy-1-methoxybenzene |
| SMILES | CCC1CCC(Oc2cc(CCl)ccc2OC)CC1 |
| InChI | InChI=1S/C16H23ClO2/c1-3-12-4-7-14(8-5-12)19-16-10-13(11-17)6-9-15(16)18-2/h6,9-10,12,14H,3-5,7-8,11H2,1-2H3 |
| InChIKey | FMCWHODMJNZUSJ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.81 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|