C13H27NO — CID 64752970
3,5-dimethyl-2-(3-methylbutoxy)cyclohexan-1-amine (PubChem CID 64752970) has the molecular formula C13H27NO and a molecular weight of 213.36 g/mol. Its IUPAC name is 3,5-dimethyl-2-(3-methylbutoxy)cyclohexan-1-amine.
| Compound Name | 3,5-dimethyl-2-(3-methylbutoxy)cyclohexan-1-amine |
|---|---|
| PubChem CID | 64752970 |
| Molecular Formula | C13H27NO |
| Molecular Weight | 213.36 g/mol |
| Exact Mass | 213.21 |
| IUPAC Name | 3,5-dimethyl-2-(3-methylbutoxy)cyclohexan-1-amine |
| SMILES | CC(C)CCOC1C(C)CC(C)CC1N |
| InChI | InChI=1S/C13H27NO/c1-9(2)5-6-15-13-11(4)7-10(3)8-12(13)14/h9-13H,5-8,14H2,1-4H3 |
| InChIKey | GAZVVEHGBHIFHQ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |