C16H24ClNOS — CID 64753469
2-(3-chlorophenyl)sulfinyl-N-ethyl-3,5-dimethylcyclohexan-1-amine (PubChem CID 64753469) has the molecular formula C16H24ClNOS and a molecular weight of 313.89 g/mol. Its IUPAC name is 2-(3-chlorophenyl)sulfinyl-N-ethyl-3,5-dimethylcyclohexan-1-amine.
| Compound Name | 2-(3-chlorophenyl)sulfinyl-N-ethyl-3,5-dimethylcyclohexan-1-amine |
|---|---|
| PubChem CID | 64753469 |
| Molecular Formula | C16H24ClNOS |
| Molecular Weight | 313.89 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | 2-(3-chlorophenyl)sulfinyl-N-ethyl-3,5-dimethylcyclohexan-1-amine |
| SMILES | CCNC1CC(C)CC(C)C1S(=O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C16H24ClNOS/c1-4-18-15-9-11(2)8-12(3)16(15)20(19)14-7-5-6-13(17)10-14/h5-7,10-12,15-16,18H,4,8-9H2,1-3H3 |
| InChIKey | LGNRGVYXKKITOY-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.89 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |