C13H25F3N2 — CID 64754071
N',N'-dimethyl-N-[4-(trifluoromethyl)cyclohexyl]butane-1,4-diamine (PubChem CID 64754071) has the molecular formula C13H25F3N2 and a molecular weight of 266.35 g/mol. Its IUPAC name is N',N'-dimethyl-N-[4-(trifluoromethyl)cyclohexyl]butane-1,4-diamine.
| Compound Name | N',N'-dimethyl-N-[4-(trifluoromethyl)cyclohexyl]butane-1,4-diamine |
|---|---|
| PubChem CID | 64754071 |
| Molecular Formula | C13H25F3N2 |
| Molecular Weight | 266.35 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | N',N'-dimethyl-N-[4-(trifluoromethyl)cyclohexyl]butane-1,4-diamine |
| SMILES | CN(C)CCCCNC1CCC(C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H25F3N2/c1-18(2)10-4-3-9-17-12-7-5-11(6-8-12)13(14,15)16/h11-12,17H,3-10H2,1-2H3 |
| InChIKey | YRQLBNLGFCAEPK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|